C18H24N2O3 — CID 118525539
tert-butyl 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate (PubChem CID 118525539) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118525539 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 4-(4-prop-2-ynoxyphenyl)piperazine-1-carboxylate |
| SMILES | C#CCOc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-5-14-22-16-8-6-15(7-9-16)19-10-12-20(13-11-19)17(21)23-18(2,3)4/h1,6-9H,10-14H2,2-4H3 |
| InChIKey | QZABLCMKZPKKFM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|