C32H34N2O — CID 102380045
(2S,6R)-2,4-dibenzyl-6-[(4-methoxyphenyl)methyl]-1-phenylpiperazine (PubChem CID 102380045) has the molecular formula C32H34N2O and a molecular weight of 462.64 g/mol. Its IUPAC name is (2S,6R)-2,4-dibenzyl-6-[(4-methoxyphenyl)methyl]-1-phenylpiperazine.
| Compound Name | (2S,6R)-2,4-dibenzyl-6-[(4-methoxyphenyl)methyl]-1-phenylpiperazine |
|---|---|
| PubChem CID | 102380045 |
| Molecular Formula | C32H34N2O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2S,6R)-2,4-dibenzyl-6-[(4-methoxyphenyl)methyl]-1-phenylpiperazine |
| SMILES | COc1ccc(C[C@@H]2CN(Cc3ccccc3)C[C@H](Cc3ccccc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H34N2O/c1-35-32-19-17-27(18-20-32)22-31-25-33(23-28-13-7-3-8-14-28)24-30(21-26-11-5-2-6-12-26)34(31)29-15-9-4-10-16-29/h2-20,30-31H,21-25H2,1H3/t30-,31+/m0/s1 |
| InChIKey | HWNGQDTWNFWVEL-IOWSJCHKSA-N |
| XLogP | 6.24 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |