C16H22N4O3S — CID 11046339
4-(8-methoxyquinolin-4-yl)-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 11046339) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-(8-methoxyquinolin-4-yl)-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-(8-methoxyquinolin-4-yl)-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 11046339 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-(8-methoxyquinolin-4-yl)-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | COc1cccc2c(N3CCN(S(=O)(=O)N(C)C)CC3)ccnc12 |
| InChI | InChI=1S/C16H22N4O3S/c1-18(2)24(21,22)20-11-9-19(10-12-20)14-7-8-17-16-13(14)5-4-6-15(16)23-3/h4-8H,9-12H2,1-3H3 |
| InChIKey | MLKMNJBJBXIILV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |