C18H22N2O3 — CID 129437284
(2R)-4-(8-methoxyquinolin-4-yl)-2-[(2R)-oxolan-2-yl]morpholine (PubChem CID 129437284) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2R)-4-(8-methoxyquinolin-4-yl)-2-[(2R)-oxolan-2-yl]morpholine.
| Compound Name | (2R)-4-(8-methoxyquinolin-4-yl)-2-[(2R)-oxolan-2-yl]morpholine |
|---|---|
| PubChem CID | 129437284 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (2R)-4-(8-methoxyquinolin-4-yl)-2-[(2R)-oxolan-2-yl]morpholine |
| SMILES | COc1cccc2c(N3CCO[C@@H]([C@H]4CCCO4)C3)ccnc12 |
| InChI | InChI=1S/C18H22N2O3/c1-21-16-5-2-4-13-14(7-8-19-18(13)16)20-9-11-23-17(12-20)15-6-3-10-22-15/h2,4-5,7-8,15,17H,3,6,9-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | YGXPAWIWSNVOCJ-NVXWUHKLSA-N |
| XLogP | 2.63 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |