C17H20FN3O3 — CID 133493384
4-(7-fluoro-6-methoxyquinazolin-4-yl)-2-(oxolan-2-yl)morpholine (PubChem CID 133493384) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 4-(7-fluoro-6-methoxyquinazolin-4-yl)-2-(oxolan-2-yl)morpholine.
| Compound Name | 4-(7-fluoro-6-methoxyquinazolin-4-yl)-2-(oxolan-2-yl)morpholine |
|---|---|
| PubChem CID | 133493384 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-(7-fluoro-6-methoxyquinazolin-4-yl)-2-(oxolan-2-yl)morpholine |
| SMILES | COc1cc2c(N3CCOC(C4CCCO4)C3)ncnc2cc1F |
| InChI | InChI=1S/C17H20FN3O3/c1-22-15-7-11-13(8-12(15)18)19-10-20-17(11)21-4-6-24-16(9-21)14-3-2-5-23-14/h7-8,10,14,16H,2-6,9H2,1H3 |
| InChIKey | ZTFAPSFMYQEGAW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |