C22H25N3O5 — CID 24855466
2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine (PubChem CID 24855466) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine.
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine |
|---|---|
| PubChem CID | 24855466 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine |
| SMILES | COc1cc(OC)cc(C2CN(c3ncnc4cc(OC)c(OC)cc34)CCO2)c1 |
| InChI | InChI=1S/C22H25N3O5/c1-26-15-7-14(8-16(9-15)27-2)21-12-25(5-6-30-21)22-17-10-19(28-3)20(29-4)11-18(17)23-13-24-22/h7-11,13,21H,5-6,12H2,1-4H3 |
| InChIKey | HPQCEMHASSFJJV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |