About 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine
2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine (PubChem CID 24855466) has the molecular formula C22H25N3O5
and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine.
Molecular Properties
| Compound Name | 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine |
| PubChem CID | 24855466 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine |
| SMILES | COc1cc(OC)cc(C2CN(c3ncnc4cc(OC)c(OC)cc34)CCO2)c1 |
| InChI | InChI=1S/C22H25N3O5/c1-26-15-7-14(8-16(9-15)27-2)21-12-25(5-6-30-21)22-17-10-19(28-3)20(29-4)11-18(17)23-13-24-22/h7-11,13,21H,5-6,12H2,1-4H3 |
| InChIKey | HPQCEMHASSFJJV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine?
The IUPAC name of 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine (CID 24855466) is 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine.
What is the SMILES notation for 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine?
The canonical SMILES for 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine is COc1cc(OC)cc(C2CN(c3ncnc4cc(OC)c(OC)cc34)CCO2)c1.
What is the InChIKey of 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine?
The InChIKey is HPQCEMHASSFJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O5/c1-26-15-7-14(8-16(9-15)27-2)21-12-25(5-6-30-21)22-17-10-19(28-3)20(29-4)11-18(17)23-13-24-22/h7-11,13,21H,5-6,12H2,1-4H3.
What are the key properties of 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine?
2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine has a molecular weight of 411.46 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)morpholine is sourced from PubChem (CID 24855466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).