C17H23N3O2S — CID 166561846
imino-[[1-(8-methoxyquinolin-4-yl)piperidin-4-yl]methyl]-methyl-oxo-λ6-sulfane (PubChem CID 166561846) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is imino-[[1-(8-methoxyquinolin-4-yl)piperidin-4-yl]methyl]-methyl-oxo-λ6-sulfane.
| Compound Name | imino-[[1-(8-methoxyquinolin-4-yl)piperidin-4-yl]methyl]-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166561846 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | imino-[[1-(8-methoxyquinolin-4-yl)piperidin-4-yl]methyl]-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)CC1CCN(c2ccnc3c(OC)cccc23)CC1 |
| InChI | InChI=1S/C17H23N3O2S/c1-22-16-5-3-4-14-15(6-9-19-17(14)16)20-10-7-13(8-11-20)12-23(2,18)21/h3-6,9,13,18H,7-8,10-12H2,1-2H3 |
| InChIKey | WSLSGYPATGKKBY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |