C16H21FN4O2S — CID 166561973
[1-[8-(fluoromethoxy)quinazolin-4-yl]piperidin-4-yl]methyl-imino-methyl-oxo-λ6-sulfane (PubChem CID 166561973) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is [1-[8-(fluoromethoxy)quinazolin-4-yl]piperidin-4-yl]methyl-imino-methyl-oxo-λ6-sulfane.
| Compound Name | [1-[8-(fluoromethoxy)quinazolin-4-yl]piperidin-4-yl]methyl-imino-methyl-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 166561973 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [1-[8-(fluoromethoxy)quinazolin-4-yl]piperidin-4-yl]methyl-imino-methyl-oxo-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)CC1CCN(c2ncnc3c(OCF)cccc23)CC1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-24(18,22)9-12-5-7-21(8-6-12)16-13-3-2-4-14(23-10-17)15(13)19-11-20-16/h2-4,11-12,18H,5-10H2,1H3 |
| InChIKey | YHBMVNLYKBLYQV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |