C19H27N4O5P — CID 166527049
1-diethoxyphosphoryl-N-[1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]formamide (PubChem CID 166527049) has the molecular formula C19H27N4O5P and a molecular weight of 422.42 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-[1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]formamide.
| Compound Name | 1-diethoxyphosphoryl-N-[1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]formamide |
|---|---|
| PubChem CID | 166527049 |
| Molecular Formula | C19H27N4O5P |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-diethoxyphosphoryl-N-[1-(8-methoxyquinazolin-4-yl)piperidin-4-yl]formamide |
| SMILES | CCOP(=O)(OCC)C(=O)NC1CCN(c2ncnc3c(OC)cccc23)CC1 |
| InChI | InChI=1S/C19H27N4O5P/c1-4-27-29(25,28-5-2)19(24)22-14-9-11-23(12-10-14)18-15-7-6-8-16(26-3)17(15)20-13-21-18/h6-8,13-14H,4-5,9-12H2,1-3H3,(H,22,24) |
| InChIKey | JJQGSJGCLLNCMP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|