C20H30N3O4P — CID 166527036
N-[(1S,3R)-3-(2-diethoxyphosphorylethyl)cyclopentyl]-8-methoxyquinazolin-4-amine (PubChem CID 166527036) has the molecular formula C20H30N3O4P and a molecular weight of 407.45 g/mol. Its IUPAC name is N-[(1S,3R)-3-(2-diethoxyphosphorylethyl)cyclopentyl]-8-methoxyquinazolin-4-amine.
| Compound Name | N-[(1S,3R)-3-(2-diethoxyphosphorylethyl)cyclopentyl]-8-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 166527036 |
| Molecular Formula | C20H30N3O4P |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[(1S,3R)-3-(2-diethoxyphosphorylethyl)cyclopentyl]-8-methoxyquinazolin-4-amine |
| SMILES | CCOP(=O)(CC[C@@H]1CC[C@H](Nc2ncnc3c(OC)cccc23)C1)OCC |
| InChI | InChI=1S/C20H30N3O4P/c1-4-26-28(24,27-5-2)12-11-15-9-10-16(13-15)23-20-17-7-6-8-18(25-3)19(17)21-14-22-20/h6-8,14-16H,4-5,9-13H2,1-3H3,(H,21,22,23)/t15-,16-/m0/s1 |
| InChIKey | IUBOWJOTVLXBIH-HOTGVXAUSA-N |
| XLogP | 4.88 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|