C22H34N3O5P — CID 166527069
2-diethoxyphosphoryl-4-[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]butan-1-ol (PubChem CID 166527069) has the molecular formula C22H34N3O5P and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-4-[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]butan-1-ol.
| Compound Name | 2-diethoxyphosphoryl-4-[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]butan-1-ol |
|---|---|
| PubChem CID | 166527069 |
| Molecular Formula | C22H34N3O5P |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 2-diethoxyphosphoryl-4-[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]butan-1-ol |
| SMILES | CCOP(=O)(OCC)C(CO)CCC1CCCN(c2ncnc3c(OC)cccc23)C1 |
| InChI | InChI=1S/C22H34N3O5P/c1-4-29-31(27,30-5-2)18(15-26)12-11-17-8-7-13-25(14-17)22-19-9-6-10-20(28-3)21(19)23-16-24-22/h6,9-10,16-18,26H,4-5,7-8,11-15H2,1-3H3 |
| InChIKey | MCILAGNOKVPZSP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|