C14H22N2O2 — CID 113371177
2-[1-(3-ethoxy-2-pyridinyl)piperidin-3-yl]ethanol (PubChem CID 113371177) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[1-(3-ethoxy-2-pyridinyl)piperidin-3-yl]ethanol.
| Compound Name | 2-[1-(3-ethoxy-2-pyridinyl)piperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 113371177 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[1-(3-ethoxy-2-pyridinyl)piperidin-3-yl]ethanol |
| SMILES | CCOc1cccnc1N1CCCC(CCO)C1 |
| InChI | InChI=1S/C14H22N2O2/c1-2-18-13-6-3-8-15-14(13)16-9-4-5-12(11-16)7-10-17/h3,6,8,12,17H,2,4-5,7,9-11H2,1H3 |
| InChIKey | GFPYBTXINQQNJF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |