C11H15FN2O — CID 94573932
[(3S)-1-(3-fluoro-2-pyridinyl)piperidin-3-yl]methanol (PubChem CID 94573932) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is [(3S)-1-(3-fluoro-2-pyridinyl)piperidin-3-yl]methanol.
| Compound Name | [(3S)-1-(3-fluoro-2-pyridinyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 94573932 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | [(3S)-1-(3-fluoro-2-pyridinyl)piperidin-3-yl]methanol |
| SMILES | OC[C@H]1CCCN(c2ncccc2F)C1 |
| InChI | InChI=1S/C11H15FN2O/c12-10-4-1-5-13-11(10)14-6-2-3-9(7-14)8-15/h1,4-5,9,15H,2-3,6-8H2/t9-/m0/s1 |
| InChIKey | QSWQKELMXCKXMP-VIFPVBQESA-N |
| XLogP | 1.43 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |