C20H30FN3O — CID 143229815
N-cyclohexyl-N-[3-[1-(3-fluoro-2-pyridinyl)piperidin-3-yl]propyl]formamide (PubChem CID 143229815) has the molecular formula C20H30FN3O and a molecular weight of 347.48 g/mol. Its IUPAC name is N-cyclohexyl-N-[3-[1-(3-fluoro-2-pyridinyl)piperidin-3-yl]propyl]formamide.
| Compound Name | N-cyclohexyl-N-[3-[1-(3-fluoro-2-pyridinyl)piperidin-3-yl]propyl]formamide |
|---|---|
| PubChem CID | 143229815 |
| Molecular Formula | C20H30FN3O |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | N-cyclohexyl-N-[3-[1-(3-fluoro-2-pyridinyl)piperidin-3-yl]propyl]formamide |
| SMILES | O=CN(CCCC1CCCN(c2ncccc2F)C1)C1CCCCC1 |
| InChI | InChI=1S/C20H30FN3O/c21-19-11-4-12-22-20(19)23-13-5-7-17(15-23)8-6-14-24(16-25)18-9-2-1-3-10-18/h4,11-12,16-18H,1-3,5-10,13-15H2 |
| InChIKey | ZZJNLELQACHOIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|