C24H34F3N3O2 — CID 143229391
N-[4-[3-[3-[cyclohexyl(formyl)amino]propyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 143229391) has the molecular formula C24H34F3N3O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[4-[3-[3-[cyclohexyl(formyl)amino]propyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-[3-[3-[cyclohexyl(formyl)amino]propyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 143229391 |
| Molecular Formula | C24H34F3N3O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-[4-[3-[3-[cyclohexyl(formyl)amino]propyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2CCCC(CCCN(C=O)C3CCCCC3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H34F3N3O2/c1-18(32)28-20-11-12-23(22(15-20)24(25,26)27)29-13-5-7-19(16-29)8-6-14-30(17-31)21-9-3-2-4-10-21/h11-12,15,17,19,21H,2-10,13-14,16H2,1H3,(H,28,32) |
| InChIKey | MEMMQLVPBNJKJU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|