C21H32BrN3O — CID 143229447
N-[3-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-3-yl]propyl]-N-cyclohexylformamide (PubChem CID 143229447) has the molecular formula C21H32BrN3O and a molecular weight of 422.41 g/mol. Its IUPAC name is N-[3-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-3-yl]propyl]-N-cyclohexylformamide.
| Compound Name | N-[3-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-3-yl]propyl]-N-cyclohexylformamide |
|---|---|
| PubChem CID | 143229447 |
| Molecular Formula | C21H32BrN3O |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-[3-[1-(3-bromo-5-methyl-2-pyridinyl)piperidin-3-yl]propyl]-N-cyclohexylformamide |
| SMILES | Cc1cnc(N2CCCC(CCCN(C=O)C3CCCCC3)C2)c(Br)c1 |
| InChI | InChI=1S/C21H32BrN3O/c1-17-13-20(22)21(23-14-17)24-11-5-7-18(15-24)8-6-12-25(16-26)19-9-3-2-4-10-19/h13-14,16,18-19H,2-12,15H2,1H3 |
| InChIKey | DJFLCHMZWHGTPQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|