C25H42N4O3 — CID 143229820
ethane;ethyl N-[6-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-4-methyl-3-pyridinyl]carbamate (PubChem CID 143229820) has the molecular formula C25H42N4O3 and a molecular weight of 446.64 g/mol. Its IUPAC name is ethane;ethyl N-[6-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-4-methyl-3-pyridinyl]carbamate.
| Compound Name | ethane;ethyl N-[6-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-4-methyl-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 143229820 |
| Molecular Formula | C25H42N4O3 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | ethane;ethyl N-[6-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-4-methyl-3-pyridinyl]carbamate |
| SMILES | CC.CCOC(=O)Nc1cnc(N2CCCC(CCN(C=O)C3CCCCC3)C2)cc1C |
| InChI | InChI=1S/C23H36N4O3.C2H6/c1-3-30-23(29)25-21-15-24-22(14-18(21)2)26-12-7-8-19(16-26)11-13-27(17-28)20-9-5-4-6-10-20;1-2/h14-15,17,19-20H,3-13,16H2,1-2H3,(H,25,29);1-2H3 |
| InChIKey | ZNKIVIKOSUWMTC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|