C24H36FN3O3 — CID 143229718
propyl N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]carbamate (PubChem CID 143229718) has the molecular formula C24H36FN3O3 and a molecular weight of 433.57 g/mol. Its IUPAC name is propyl N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]carbamate.
| Compound Name | propyl N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 143229718 |
| Molecular Formula | C24H36FN3O3 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | propyl N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]carbamate |
| SMILES | CCCOC(=O)Nc1ccc(N2CCCC(CCN(C=O)C3CCCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C24H36FN3O3/c1-2-15-31-24(30)26-20-10-11-23(22(25)16-20)27-13-6-7-19(17-27)12-14-28(18-29)21-8-4-3-5-9-21/h10-11,16,18-19,21H,2-9,12-15,17H2,1H3,(H,26,30) |
| InChIKey | GHDZWHLMGOPGOZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|