C23H32FN3O3 — CID 143229538
ethyl N-[3-fluoro-4-[(3S)-3-[2-[formyl-(1-methylcyclopent-3-en-1-yl)amino]ethyl]piperidin-1-yl]phenyl]carbamate (PubChem CID 143229538) has the molecular formula C23H32FN3O3 and a molecular weight of 417.53 g/mol. Its IUPAC name is ethyl N-[3-fluoro-4-[(3S)-3-[2-[formyl-(1-methylcyclopent-3-en-1-yl)amino]ethyl]piperidin-1-yl]phenyl]carbamate.
| Compound Name | ethyl N-[3-fluoro-4-[(3S)-3-[2-[formyl-(1-methylcyclopent-3-en-1-yl)amino]ethyl]piperidin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 143229538 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | ethyl N-[3-fluoro-4-[(3S)-3-[2-[formyl-(1-methylcyclopent-3-en-1-yl)amino]ethyl]piperidin-1-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N2CCC[C@@H](CCN(C=O)C3(C)CC=CC3)C2)c(F)c1 |
| InChI | InChI=1S/C23H32FN3O3/c1-3-30-22(29)25-19-8-9-21(20(24)15-19)26-13-6-7-18(16-26)10-14-27(17-28)23(2)11-4-5-12-23/h4-5,8-9,15,17-18H,3,6-7,10-14,16H2,1-2H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | KDJWYAHLAPTROU-SFHVURJKSA-N |
| XLogP | 4.57 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|