C25H36F3N3O3 — CID 143229692
[4-[3-[4-[cycloheptyl(formyl)amino]butyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 143229692) has the molecular formula C25H36F3N3O3 and a molecular weight of 483.58 g/mol. Its IUPAC name is [4-[3-[4-[cycloheptyl(formyl)amino]butyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [4-[3-[4-[cycloheptyl(formyl)amino]butyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 143229692 |
| Molecular Formula | C25H36F3N3O3 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | [4-[3-[4-[cycloheptyl(formyl)amino]butyl]piperidin-1-yl]-3-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=CN(CCCCC1CCCN(c2ccc(NC(=O)O)cc2C(F)(F)F)C1)C1CCCCCC1 |
| InChI | InChI=1S/C25H36F3N3O3/c26-25(27,28)22-16-20(29-24(33)34)12-13-23(22)30-15-7-9-19(17-30)8-5-6-14-31(18-32)21-10-3-1-2-4-11-21/h12-13,16,18-19,21,29H,1-11,14-15,17H2,(H,33,34) |
| InChIKey | ONTADNSYVVBZDD-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|