C26H42F3N3O3 — CID 143229615
N-cyclohexyl-N-ethylformamide;ethane;methyl N-[4-(3-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 143229615) has the molecular formula C26H42F3N3O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-cyclohexyl-N-ethylformamide;ethane;methyl N-[4-(3-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | N-cyclohexyl-N-ethylformamide;ethane;methyl N-[4-(3-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 143229615 |
| Molecular Formula | C26H42F3N3O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.32 |
| IUPAC Name | N-cyclohexyl-N-ethylformamide;ethane;methyl N-[4-(3-methylpiperidin-1-yl)-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC.CCN(C=O)C1CCCCC1.COC(=O)Nc1ccc(N2CCCC(C)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O2.C9H17NO.C2H6/c1-10-4-3-7-20(9-10)13-6-5-11(19-14(21)22-2)8-12(13)15(16,17)18;1-2-10(8-11)9-6-4-3-5-7-9;1-2/h5-6,8,10H,3-4,7,9H2,1-2H3,(H,19,21);8-9H,2-7H2,1H3;1-2H3 |
| InChIKey | MYYRCOUPCJTGMP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|