C25H38FN3O3 — CID 143229402
N-cyclohexyl-N-ethylformamide;3-[3-fluoro-4-(3-methylpiperidin-1-yl)phenyl]-1,3-oxazinan-2-one (PubChem CID 143229402) has the molecular formula C25H38FN3O3 and a molecular weight of 447.60 g/mol. Its IUPAC name is N-cyclohexyl-N-ethylformamide;3-[3-fluoro-4-(3-methylpiperidin-1-yl)phenyl]-1,3-oxazinan-2-one.
| Compound Name | N-cyclohexyl-N-ethylformamide;3-[3-fluoro-4-(3-methylpiperidin-1-yl)phenyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 143229402 |
| Molecular Formula | C25H38FN3O3 |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | N-cyclohexyl-N-ethylformamide;3-[3-fluoro-4-(3-methylpiperidin-1-yl)phenyl]-1,3-oxazinan-2-one |
| SMILES | CC1CCCN(c2ccc(N3CCCOC3=O)cc2F)C1.CCN(C=O)C1CCCCC1 |
| InChI | InChI=1S/C16H21FN2O2.C9H17NO/c1-12-4-2-7-18(11-12)15-6-5-13(10-14(15)17)19-8-3-9-21-16(19)20;1-2-10(8-11)9-6-4-3-5-7-9/h5-6,10,12H,2-4,7-9,11H2,1H3;8-9H,2-7H2,1H3 |
| InChIKey | CNACSNXZCHIULP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|