C20H31ClFN3O2 — CID 143229493
5-chloro-3-fluoro-2-(3-methylpiperidin-1-yl)pyridine;N-ethyl-N-(4-hydroxycyclohexyl)formamide (PubChem CID 143229493) has the molecular formula C20H31ClFN3O2 and a molecular weight of 399.94 g/mol. Its IUPAC name is 5-chloro-3-fluoro-2-(3-methylpiperidin-1-yl)pyridine;N-ethyl-N-(4-hydroxycyclohexyl)formamide.
| Compound Name | 5-chloro-3-fluoro-2-(3-methylpiperidin-1-yl)pyridine;N-ethyl-N-(4-hydroxycyclohexyl)formamide |
|---|---|
| PubChem CID | 143229493 |
| Molecular Formula | C20H31ClFN3O2 |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 5-chloro-3-fluoro-2-(3-methylpiperidin-1-yl)pyridine;N-ethyl-N-(4-hydroxycyclohexyl)formamide |
| SMILES | CC1CCCN(c2ncc(Cl)cc2F)C1.CCN(C=O)C1CCC(O)CC1 |
| InChI | InChI=1S/C11H14ClFN2.C9H17NO2/c1-8-3-2-4-15(7-8)11-10(13)5-9(12)6-14-11;1-2-10(7-11)8-3-5-9(12)6-4-8/h5-6,8H,2-4,7H2,1H3;7-9,12H,2-6H2,1H3 |
| InChIKey | PGXBAVWGMCIUSH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|