C26H38N4O2 — CID 143229409
N-cyclohexyl-N-ethylformamide;2-methoxy-5-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]pyridine (PubChem CID 143229409) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-cyclohexyl-N-ethylformamide;2-methoxy-5-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]pyridine.
| Compound Name | N-cyclohexyl-N-ethylformamide;2-methoxy-5-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]pyridine |
|---|---|
| PubChem CID | 143229409 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | N-cyclohexyl-N-ethylformamide;2-methoxy-5-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]pyridine |
| SMILES | CCN(C=O)C1CCCCC1.COc1ccc(-c2ccc(N3CCCC(C)C3)nc2)cn1 |
| InChI | InChI=1S/C17H21N3O.C9H17NO/c1-13-4-3-9-20(12-13)16-7-5-14(10-18-16)15-6-8-17(21-2)19-11-15;1-2-10(8-11)9-6-4-3-5-7-9/h5-8,10-11,13H,3-4,9,12H2,1-2H3;8-9H,2-7H2,1H3 |
| InChIKey | PQGOCLFLAAZYFN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|