C28H40N4O2 — CID 143229412
N-cyclohexyl-N-methylformamide;N,N-dimethyl-4-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]benzamide (PubChem CID 143229412) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is N-cyclohexyl-N-methylformamide;N,N-dimethyl-4-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]benzamide.
| Compound Name | N-cyclohexyl-N-methylformamide;N,N-dimethyl-4-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 143229412 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | N-cyclohexyl-N-methylformamide;N,N-dimethyl-4-[6-(3-methylpiperidin-1-yl)-3-pyridinyl]benzamide |
| SMILES | CC1CCCN(c2ccc(-c3ccc(C(=O)N(C)C)cc3)cn2)C1.CN(C=O)C1CCCCC1 |
| InChI | InChI=1S/C20H25N3O.C8H15NO/c1-15-5-4-12-23(14-15)19-11-10-18(13-21-19)16-6-8-17(9-7-16)20(24)22(2)3;1-9(7-10)8-5-3-2-4-6-8/h6-11,13,15H,4-5,12,14H2,1-3H3;7-8H,2-6H2,1H3 |
| InChIKey | HSEPYWAIIXPUPQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|