C24H35ClN4O2 — CID 143229736
N-(2-chlorophenyl)-N-methylformamide;ethane;N-ethyl-6-(3-methylpiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 143229736) has the molecular formula C24H35ClN4O2 and a molecular weight of 447.02 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-methylformamide;ethane;N-ethyl-6-(3-methylpiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-N-methylformamide;ethane;N-ethyl-6-(3-methylpiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143229736 |
| Molecular Formula | C24H35ClN4O2 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-(2-chlorophenyl)-N-methylformamide;ethane;N-ethyl-6-(3-methylpiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC.CCNC(=O)c1ccc(N2CCCC(C)C2)nc1.CN(C=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H21N3O.C8H8ClNO.C2H6/c1-3-15-14(18)12-6-7-13(16-9-12)17-8-4-5-11(2)10-17;1-10(6-11)8-5-3-2-4-7(8)9;1-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,15,18);2-6H,1H3;1-2H3 |
| InChIKey | SSAMZXQSDAMGCC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|