C20H28F2N2O — CID 143229552
N-cyclohexyl-N-[2-[1-(2,5-difluorophenyl)piperidin-3-yl]ethyl]formamide (PubChem CID 143229552) has the molecular formula C20H28F2N2O and a molecular weight of 350.45 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[1-(2,5-difluorophenyl)piperidin-3-yl]ethyl]formamide.
| Compound Name | N-cyclohexyl-N-[2-[1-(2,5-difluorophenyl)piperidin-3-yl]ethyl]formamide |
|---|---|
| PubChem CID | 143229552 |
| Molecular Formula | C20H28F2N2O |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | N-cyclohexyl-N-[2-[1-(2,5-difluorophenyl)piperidin-3-yl]ethyl]formamide |
| SMILES | O=CN(CCC1CCCN(c2cc(F)ccc2F)C1)C1CCCCC1 |
| InChI | InChI=1S/C20H28F2N2O/c21-17-8-9-19(22)20(13-17)23-11-4-5-16(14-23)10-12-24(15-25)18-6-2-1-3-7-18/h8-9,13,15-16,18H,1-7,10-12,14H2 |
| InChIKey | OMUYPUMJTLJJPU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|