C26H36FN3O3 — CID 143229829
N-cyclohexyl-N-[2-[1-(3-fluoro-4-pyridin-4-yloxyphenyl)piperidin-3-yl]ethyl]formamide;methanol (PubChem CID 143229829) has the molecular formula C26H36FN3O3 and a molecular weight of 457.59 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[1-(3-fluoro-4-pyridin-4-yloxyphenyl)piperidin-3-yl]ethyl]formamide;methanol.
| Compound Name | N-cyclohexyl-N-[2-[1-(3-fluoro-4-pyridin-4-yloxyphenyl)piperidin-3-yl]ethyl]formamide;methanol |
|---|---|
| PubChem CID | 143229829 |
| Molecular Formula | C26H36FN3O3 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | N-cyclohexyl-N-[2-[1-(3-fluoro-4-pyridin-4-yloxyphenyl)piperidin-3-yl]ethyl]formamide;methanol |
| SMILES | CO.O=CN(CCC1CCCN(c2ccc(Oc3ccncc3)c(F)c2)C1)C1CCCCC1 |
| InChI | InChI=1S/C25H32FN3O2.CH4O/c26-24-17-22(8-9-25(24)31-23-10-13-27-14-11-23)28-15-4-5-20(18-28)12-16-29(19-30)21-6-2-1-3-7-21;1-2/h8-11,13-14,17,19-21H,1-7,12,15-16,18H2;2H,1H3 |
| InChIKey | QLISEDILSMSPAY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|