C26H34FN3O3 — CID 143229435
N-[3-[1-(2-fluoro-4-pyridin-3-yloxyphenyl)piperidin-3-yl]propyl]-N-(4-hydroxycyclohexyl)formamide (PubChem CID 143229435) has the molecular formula C26H34FN3O3 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[3-[1-(2-fluoro-4-pyridin-3-yloxyphenyl)piperidin-3-yl]propyl]-N-(4-hydroxycyclohexyl)formamide.
| Compound Name | N-[3-[1-(2-fluoro-4-pyridin-3-yloxyphenyl)piperidin-3-yl]propyl]-N-(4-hydroxycyclohexyl)formamide |
|---|---|
| PubChem CID | 143229435 |
| Molecular Formula | C26H34FN3O3 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[3-[1-(2-fluoro-4-pyridin-3-yloxyphenyl)piperidin-3-yl]propyl]-N-(4-hydroxycyclohexyl)formamide |
| SMILES | O=CN(CCCC1CCCN(c2ccc(Oc3cccnc3)cc2F)C1)C1CCC(O)CC1 |
| InChI | InChI=1S/C26H34FN3O3/c27-25-16-23(33-24-6-1-13-28-17-24)11-12-26(25)29-14-2-4-20(18-29)5-3-15-30(19-31)21-7-9-22(32)10-8-21/h1,6,11-13,16-17,19-22,32H,2-5,7-10,14-15,18H2 |
| InChIKey | YGUVRFSUMXMLIG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|