C28H44FN3O3 — CID 143229655
N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]cyclohexanecarboxamide;methanol (PubChem CID 143229655) has the molecular formula C28H44FN3O3 and a molecular weight of 489.68 g/mol. Its IUPAC name is N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]cyclohexanecarboxamide;methanol.
| Compound Name | N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]cyclohexanecarboxamide;methanol |
|---|---|
| PubChem CID | 143229655 |
| Molecular Formula | C28H44FN3O3 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-[4-[3-[2-[cyclohexyl(formyl)amino]ethyl]piperidin-1-yl]-3-fluorophenyl]cyclohexanecarboxamide;methanol |
| SMILES | CO.O=CN(CCC1CCCN(c2ccc(NC(=O)C3CCCCC3)cc2F)C1)C1CCCCC1 |
| InChI | InChI=1S/C27H40FN3O2.CH4O/c28-25-18-23(29-27(33)22-9-3-1-4-10-22)13-14-26(25)30-16-7-8-21(19-30)15-17-31(20-32)24-11-5-2-6-12-24;1-2/h13-14,18,20-22,24H,1-12,15-17,19H2,(H,29,33);2H,1H3 |
| InChIKey | IJOQTJJQIYVMLU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|