C23H32FN3O3 — CID 24856417
[1-[4-(cyclopentanecarbonylamino)-2-fluorophenyl]piperidin-3-yl] piperidine-1-carboxylate (PubChem CID 24856417) has the molecular formula C23H32FN3O3 and a molecular weight of 417.53 g/mol. Its IUPAC name is [1-[4-(cyclopentanecarbonylamino)-2-fluorophenyl]piperidin-3-yl] piperidine-1-carboxylate.
| Compound Name | [1-[4-(cyclopentanecarbonylamino)-2-fluorophenyl]piperidin-3-yl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24856417 |
| Molecular Formula | C23H32FN3O3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [1-[4-(cyclopentanecarbonylamino)-2-fluorophenyl]piperidin-3-yl] piperidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(N2CCCC(OC(=O)N3CCCCC3)C2)c(F)c1)C1CCCC1 |
| InChI | InChI=1S/C23H32FN3O3/c24-20-15-18(25-22(28)17-7-2-3-8-17)10-11-21(20)27-14-6-9-19(16-27)30-23(29)26-12-4-1-5-13-26/h10-11,15,17,19H,1-9,12-14,16H2,(H,25,28) |
| InChIKey | NZXHCXMADZSQLZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|