C20H28FN3O4 — CID 100866593
methyl (3R)-1-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]carbamoyl]piperidine-3-carboxylate (PubChem CID 100866593) has the molecular formula C20H28FN3O4 and a molecular weight of 393.46 g/mol. Its IUPAC name is methyl (3R)-1-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]carbamoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3R)-1-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 100866593 |
| Molecular Formula | C20H28FN3O4 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | methyl (3R)-1-[[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-fluorophenyl]carbamoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(N3C[C@H](C)O[C@@H](C)C3)c(F)c2)C1 |
| InChI | InChI=1S/C20H28FN3O4/c1-13-10-24(11-14(2)28-13)18-7-6-16(9-17(18)21)22-20(26)23-8-4-5-15(12-23)19(25)27-3/h6-7,9,13-15H,4-5,8,10-12H2,1-3H3,(H,22,26)/t13-,14-,15+/m0/s1 |
| InChIKey | VAJSNIUHAUKOTE-SOUVJXGZSA-N |
| XLogP | 2.86 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|