C19H26FN3O4 — CID 24857731
[1-(4-acetamido-2-fluorophenyl)piperidin-3-yl] 4-hydroxypiperidine-1-carboxylate (PubChem CID 24857731) has the molecular formula C19H26FN3O4 and a molecular weight of 379.43 g/mol. Its IUPAC name is [1-(4-acetamido-2-fluorophenyl)piperidin-3-yl] 4-hydroxypiperidine-1-carboxylate.
| Compound Name | [1-(4-acetamido-2-fluorophenyl)piperidin-3-yl] 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 24857731 |
| Molecular Formula | C19H26FN3O4 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [1-(4-acetamido-2-fluorophenyl)piperidin-3-yl] 4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(=O)Nc1ccc(N2CCCC(OC(=O)N3CCC(O)CC3)C2)c(F)c1 |
| InChI | InChI=1S/C19H26FN3O4/c1-13(24)21-14-4-5-18(17(20)11-14)23-8-2-3-16(12-23)27-19(26)22-9-6-15(25)7-10-22/h4-5,11,15-16,25H,2-3,6-10,12H2,1H3,(H,21,24) |
| InChIKey | IEYDWHXRJKDKBA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|