C22H37N3O — CID 143229407
N-cyclohexyl-N-[2-[1-(3-methyl-2-pyridinyl)piperidin-3-yl]ethyl]formamide;ethane (PubChem CID 143229407) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is N-cyclohexyl-N-[2-[1-(3-methyl-2-pyridinyl)piperidin-3-yl]ethyl]formamide;ethane.
| Compound Name | N-cyclohexyl-N-[2-[1-(3-methyl-2-pyridinyl)piperidin-3-yl]ethyl]formamide;ethane |
|---|---|
| PubChem CID | 143229407 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | N-cyclohexyl-N-[2-[1-(3-methyl-2-pyridinyl)piperidin-3-yl]ethyl]formamide;ethane |
| SMILES | CC.Cc1cccnc1N1CCCC(CCN(C=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C20H31N3O.C2H6/c1-17-7-5-12-21-20(17)22-13-6-8-18(15-22)11-14-23(16-24)19-9-3-2-4-10-19;1-2/h5,7,12,16,18-19H,2-4,6,8-11,13-15H2,1H3;1-2H3 |
| InChIKey | PTDZQOKTESGXOJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|