C19H26N4O2 — CID 143229666
N-[2-[1-(3-cyano-2-pyridinyl)piperidin-3-yl]ethyl]-N-(oxan-4-yl)formamide (PubChem CID 143229666) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[2-[1-(3-cyano-2-pyridinyl)piperidin-3-yl]ethyl]-N-(oxan-4-yl)formamide.
| Compound Name | N-[2-[1-(3-cyano-2-pyridinyl)piperidin-3-yl]ethyl]-N-(oxan-4-yl)formamide |
|---|---|
| PubChem CID | 143229666 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[2-[1-(3-cyano-2-pyridinyl)piperidin-3-yl]ethyl]-N-(oxan-4-yl)formamide |
| SMILES | N#Cc1cccnc1N1CCCC(CCN(C=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C19H26N4O2/c20-13-17-4-1-8-21-19(17)22-9-2-3-16(14-22)5-10-23(15-24)18-6-11-25-12-7-18/h1,4,8,15-16,18H,2-3,5-7,9-12,14H2 |
| InChIKey | UNNATLCFBQORNB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|