C21H27F3N4O — CID 143229364
N-(4-cyanocyclohexyl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide (PubChem CID 143229364) has the molecular formula C21H27F3N4O and a molecular weight of 408.47 g/mol. Its IUPAC name is N-(4-cyanocyclohexyl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide.
| Compound Name | N-(4-cyanocyclohexyl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide |
|---|---|
| PubChem CID | 143229364 |
| Molecular Formula | C21H27F3N4O |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-(4-cyanocyclohexyl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide |
| SMILES | N#CC1CCC(N(C=O)CCC2CCCN(c3ccc(C(F)(F)F)cn3)C2)CC1 |
| InChI | InChI=1S/C21H27F3N4O/c22-21(23,24)18-5-8-20(26-13-18)27-10-1-2-17(14-27)9-11-28(15-29)19-6-3-16(12-25)4-7-19/h5,8,13,15-17,19H,1-4,6-7,9-11,14H2 |
| InChIKey | DWGFNDUJAHAZCR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|