C21H30F3N3O — CID 143229354
N-(3-methylhex-5-en-3-yl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide (PubChem CID 143229354) has the molecular formula C21H30F3N3O and a molecular weight of 397.49 g/mol. Its IUPAC name is N-(3-methylhex-5-en-3-yl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide.
| Compound Name | N-(3-methylhex-5-en-3-yl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide |
|---|---|
| PubChem CID | 143229354 |
| Molecular Formula | C21H30F3N3O |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-(3-methylhex-5-en-3-yl)-N-[2-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]ethyl]formamide |
| SMILES | C=CCC(C)(CC)N(C=O)CCC1CCCN(c2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C21H30F3N3O/c1-4-11-20(3,5-2)27(16-28)13-10-17-7-6-12-26(15-17)19-9-8-18(14-25-19)21(22,23)24/h4,8-9,14,16-17H,1,5-7,10-13,15H2,2-3H3 |
| InChIKey | FVQHNLOZSZMJRU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|