C19H21Cl2N3O — CID 143229668
N-(2-chlorophenyl)-N-[2-[1-(3-chloro-2-pyridinyl)piperidin-3-yl]ethyl]formamide (PubChem CID 143229668) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N-[2-[1-(3-chloro-2-pyridinyl)piperidin-3-yl]ethyl]formamide.
| Compound Name | N-(2-chlorophenyl)-N-[2-[1-(3-chloro-2-pyridinyl)piperidin-3-yl]ethyl]formamide |
|---|---|
| PubChem CID | 143229668 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-(2-chlorophenyl)-N-[2-[1-(3-chloro-2-pyridinyl)piperidin-3-yl]ethyl]formamide |
| SMILES | O=CN(CCC1CCCN(c2ncccc2Cl)C1)c1ccccc1Cl |
| InChI | InChI=1S/C19H21Cl2N3O/c20-16-6-1-2-8-18(16)24(14-25)12-9-15-5-4-11-23(13-15)19-17(21)7-3-10-22-19/h1-3,6-8,10,14-15H,4-5,9,11-13H2 |
| InChIKey | MUPGCZQMJIKLHC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|