C20H25N7O — CID 171994800
2-[3-[methyl-(4-morpholin-4-ylpyrimidin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 171994800) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 2-[3-[methyl-(4-morpholin-4-ylpyrimidin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[3-[methyl-(4-morpholin-4-ylpyrimidin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171994800 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 2-[3-[methyl-(4-morpholin-4-ylpyrimidin-2-yl)amino]piperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | CN(c1nccc(N2CCOCC2)n1)C1CCCN(c2ncccc2C#N)C1 |
| InChI | InChI=1S/C20H25N7O/c1-25(20-23-8-6-18(24-20)26-10-12-28-13-11-26)17-5-3-9-27(15-17)19-16(14-21)4-2-7-22-19/h2,4,6-8,17H,3,5,9-13,15H2,1H3 |
| InChIKey | KGPKJYYOROBHKU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |