C15H19N3O — CID 166225727
2-(6-cyclobutyl-1,4-oxazepan-4-yl)pyridine-3-carbonitrile (PubChem CID 166225727) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-(6-cyclobutyl-1,4-oxazepan-4-yl)pyridine-3-carbonitrile.
| Compound Name | 2-(6-cyclobutyl-1,4-oxazepan-4-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166225727 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-(6-cyclobutyl-1,4-oxazepan-4-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCOCC(C2CCC2)C1 |
| InChI | InChI=1S/C15H19N3O/c16-9-13-5-2-6-17-15(13)18-7-8-19-11-14(10-18)12-3-1-4-12/h2,5-6,12,14H,1,3-4,7-8,10-11H2 |
| InChIKey | JLQJJRFKTOQKNG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |