C15H20N4O3S — CID 97344026
2-[(3R)-3-morpholin-4-ylsulfonylpiperidin-1-yl]pyridine-3-carbonitrile (PubChem CID 97344026) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[(3R)-3-morpholin-4-ylsulfonylpiperidin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 2-[(3R)-3-morpholin-4-ylsulfonylpiperidin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97344026 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[(3R)-3-morpholin-4-ylsulfonylpiperidin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N1CCC[C@@H](S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C15H20N4O3S/c16-11-13-3-1-5-17-15(13)18-6-2-4-14(12-18)23(20,21)19-7-9-22-10-8-19/h1,3,5,14H,2,4,6-10,12H2/t14-/m1/s1 |
| InChIKey | JHGAOOXOGKGGBB-CQSZACIVSA-N |
| XLogP | 0.58 |
| TPSA | 86.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |