C15H20F2N2O2 — CID 79835282
methyl 4-[3-(2-aminoethyl)piperidin-1-yl]-2,3-difluorobenzoate (PubChem CID 79835282) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is methyl 4-[3-(2-aminoethyl)piperidin-1-yl]-2,3-difluorobenzoate.
| Compound Name | methyl 4-[3-(2-aminoethyl)piperidin-1-yl]-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 79835282 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | methyl 4-[3-(2-aminoethyl)piperidin-1-yl]-2,3-difluorobenzoate |
| SMILES | COC(=O)c1ccc(N2CCCC(CCN)C2)c(F)c1F |
| InChI | InChI=1S/C15H20F2N2O2/c1-21-15(20)11-4-5-12(14(17)13(11)16)19-8-2-3-10(9-19)6-7-18/h4-5,10H,2-3,6-9,18H2,1H3 |
| InChIKey | PKQKVTWWSQLTPR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |