C23H35ClN4O4 — CID 143229726
propan-2-yl N-[5-chloro-6-[3-[3-[formyl(oxan-4-yl)amino]propyl]piperidin-1-yl]-3-pyridinyl]carbamate (PubChem CID 143229726) has the molecular formula C23H35ClN4O4 and a molecular weight of 467.01 g/mol. Its IUPAC name is propan-2-yl N-[5-chloro-6-[3-[3-[formyl(oxan-4-yl)amino]propyl]piperidin-1-yl]-3-pyridinyl]carbamate.
| Compound Name | propan-2-yl N-[5-chloro-6-[3-[3-[formyl(oxan-4-yl)amino]propyl]piperidin-1-yl]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 143229726 |
| Molecular Formula | C23H35ClN4O4 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | propan-2-yl N-[5-chloro-6-[3-[3-[formyl(oxan-4-yl)amino]propyl]piperidin-1-yl]-3-pyridinyl]carbamate |
| SMILES | CC(C)OC(=O)Nc1cnc(N2CCCC(CCCN(C=O)C3CCOCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C23H35ClN4O4/c1-17(2)32-23(30)26-19-13-21(24)22(25-14-19)27-9-3-5-18(15-27)6-4-10-28(16-29)20-7-11-31-12-8-20/h13-14,16-18,20H,3-12,15H2,1-2H3,(H,26,30) |
| InChIKey | WBJJGGWJBMWQHF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|