C16H22N3O5P — CID 166527093
[(3S)-1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxymethylphosphonic acid (PubChem CID 166527093) has the molecular formula C16H22N3O5P and a molecular weight of 367.34 g/mol. Its IUPAC name is [(3S)-1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxymethylphosphonic acid.
| Compound Name | [(3S)-1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxymethylphosphonic acid |
|---|---|
| PubChem CID | 166527093 |
| Molecular Formula | C16H22N3O5P |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [(3S)-1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxymethylphosphonic acid |
| SMILES | COc1cccc2c(N3CCC[C@H](COCP(=O)(O)O)C3)ncnc12 |
| InChI | InChI=1S/C16H22N3O5P/c1-23-14-6-2-5-13-15(14)17-10-18-16(13)19-7-3-4-12(8-19)9-24-11-25(20,21)22/h2,5-6,10,12H,3-4,7-9,11H2,1H3,(H2,20,21,22)/t12-/m0/s1 |
| InChIKey | JTXDMQBNKXVJQA-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|