C30H36N6O5P+ — CID 175457534
bis[[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxy]-oxophosphanium (PubChem CID 175457534) has the molecular formula C30H36N6O5P+ and a molecular weight of 591.63 g/mol. Its IUPAC name is bis[[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxy]-oxophosphanium.
| Compound Name | bis[[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175457534 |
| Molecular Formula | C30H36N6O5P+ |
| Molecular Weight | 591.63 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | bis[[1-(8-methoxyquinazolin-4-yl)piperidin-3-yl]methoxy]-oxophosphanium |
| SMILES | COc1cccc2c(N3CCCC(CO[P+](=O)OCC4CCCN(c5ncnc6c(OC)cccc56)C4)C3)ncnc12 |
| InChI | InChI=1S/C30H36N6O5P/c1-38-25-11-3-9-23-27(25)31-19-33-29(23)35-13-5-7-21(15-35)17-40-42(37)41-18-22-8-6-14-36(16-22)30-24-10-4-12-26(39-2)28(24)32-20-34-30/h3-4,9-12,19-22H,5-8,13-18H2,1-2H3/q+1 |
| InChIKey | JYBDNPXADURXMN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 112.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|