C13H15N3OS — CID 171802301
4-(8-methoxyquinazolin-4-yl)thiomorpholine (PubChem CID 171802301) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-(8-methoxyquinazolin-4-yl)thiomorpholine.
| Compound Name | 4-(8-methoxyquinazolin-4-yl)thiomorpholine |
|---|---|
| PubChem CID | 171802301 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-(8-methoxyquinazolin-4-yl)thiomorpholine |
| SMILES | COc1cccc2c(N3CCSCC3)ncnc12 |
| InChI | InChI=1S/C13H15N3OS/c1-17-11-4-2-3-10-12(11)14-9-15-13(10)16-5-7-18-8-6-16/h2-4,9H,5-8H2,1H3 |
| InChIKey | UMKYHTKHHFDNHY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |