About 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea
4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea (PubChem CID 171802302) has the molecular formula C14H18FN5O2S
and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea.
Molecular Properties
| Compound Name | 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea |
| PubChem CID | 171802302 |
| Molecular Formula | C14H18FN5O2S |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea |
| SMILES | COc1cc(F)cc2c(N3CCSCC3)ncnc12.NC(N)=O |
| InChI | InChI=1S/C13H14FN3OS.CH4N2O/c1-18-11-7-9(14)6-10-12(11)15-8-16-13(10)17-2-4-19-5-3-17;2-1(3)4/h6-8H,2-5H2,1H3;(H4,2,3,4) |
| InChIKey | SDNLERINWZVKDN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea?
The IUPAC name of 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea (CID 171802302) is 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea.
What is the SMILES notation for 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea?
The canonical SMILES for 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea is COc1cc(F)cc2c(N3CCSCC3)ncnc12.NC(N)=O.
What is the InChIKey of 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea?
The InChIKey is SDNLERINWZVKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3OS.CH4N2O/c1-18-11-7-9(14)6-10-12(11)15-8-16-13(10)17-2-4-19-5-3-17;2-1(3)4/h6-8H,2-5H2,1H3;(H4,2,3,4).
What are the key properties of 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea?
4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea has a molecular weight of 339.40 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-8-methoxyquinazolin-4-yl)thiomorpholine;urea is sourced from PubChem (CID 171802302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).