C18H25N3O4 — CID 86202989
4-ethyl-1-(6,7,8-trimethoxyquinazolin-4-yl)piperidin-4-ol (PubChem CID 86202989) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-ethyl-1-(6,7,8-trimethoxyquinazolin-4-yl)piperidin-4-ol.
| Compound Name | 4-ethyl-1-(6,7,8-trimethoxyquinazolin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 86202989 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 4-ethyl-1-(6,7,8-trimethoxyquinazolin-4-yl)piperidin-4-ol |
| SMILES | CCC1(O)CCN(c2ncnc3c(OC)c(OC)c(OC)cc23)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-5-18(22)6-8-21(9-7-18)17-12-10-13(23-2)15(24-3)16(25-4)14(12)19-11-20-17/h10-11,22H,5-9H2,1-4H3 |
| InChIKey | LCWXULZJMUEBJE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |