About 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol
4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol (PubChem CID 24877105) has the molecular formula C23H27N3O4
and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol |
| PubChem CID | 24877105 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol |
| SMILES | COc1cc2c(N3CCC(O)(Cc4ccccc4)CC3)nncc2c(OC)c1OC |
| InChI | InChI=1S/C23H27N3O4/c1-28-19-13-17-18(20(29-2)21(19)30-3)15-24-25-22(17)26-11-9-23(27,10-12-26)14-16-7-5-4-6-8-16/h4-8,13,15,27H,9-12,14H2,1-3H3 |
| InChIKey | HPMKDNVCMIYIDQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol?
The IUPAC name of 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol (CID 24877105) is 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol.
What is the SMILES notation for 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol?
The canonical SMILES for 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol is COc1cc2c(N3CCC(O)(Cc4ccccc4)CC3)nncc2c(OC)c1OC.
What is the InChIKey of 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol?
The InChIKey is HPMKDNVCMIYIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O4/c1-28-19-13-17-18(20(29-2)21(19)30-3)15-24-25-22(17)26-11-9-23(27,10-12-26)14-16-7-5-4-6-8-16/h4-8,13,15,27H,9-12,14H2,1-3H3.
What are the key properties of 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol?
4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol has a molecular weight of 409.49 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol is sourced from PubChem (CID 24877105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).