C23H27N3O4 — CID 24877105
4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol (PubChem CID 24877105) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol.
| Compound Name | 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 24877105 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-benzyl-1-(5,6,7-trimethoxyphthalazin-1-yl)piperidin-4-ol |
| SMILES | COc1cc2c(N3CCC(O)(Cc4ccccc4)CC3)nncc2c(OC)c1OC |
| InChI | InChI=1S/C23H27N3O4/c1-28-19-13-17-18(20(29-2)21(19)30-3)15-24-25-22(17)26-11-9-23(27,10-12-26)14-16-7-5-4-6-8-16/h4-8,13,15,27H,9-12,14H2,1-3H3 |
| InChIKey | HPMKDNVCMIYIDQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |