C27H35N5O4 — CID 13362495
2,6-bis(pyrrolidin-1-ylmethyl)-4-[(6,7,8-trimethoxyquinazolin-4-yl)amino]phenol (PubChem CID 13362495) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 2,6-bis(pyrrolidin-1-ylmethyl)-4-[(6,7,8-trimethoxyquinazolin-4-yl)amino]phenol.
| Compound Name | 2,6-bis(pyrrolidin-1-ylmethyl)-4-[(6,7,8-trimethoxyquinazolin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 13362495 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 2,6-bis(pyrrolidin-1-ylmethyl)-4-[(6,7,8-trimethoxyquinazolin-4-yl)amino]phenol |
| SMILES | COc1cc2c(Nc3cc(CN4CCCC4)c(O)c(CN4CCCC4)c3)ncnc2c(OC)c1OC |
| InChI | InChI=1S/C27H35N5O4/c1-34-22-14-21-23(26(36-3)25(22)35-2)28-17-29-27(21)30-20-12-18(15-31-8-4-5-9-31)24(33)19(13-20)16-32-10-6-7-11-32/h12-14,17,33H,4-11,15-16H2,1-3H3,(H,28,29,30) |
| InChIKey | GZCWZDPIMYNNPT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|